C22H27N3O5 — CID 66640921
ethyl 3-[(2-butoxy-2-oxoethyl)carbamoyl]-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 66640921) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is ethyl 3-[(2-butoxy-2-oxoethyl)carbamoyl]-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | ethyl 3-[(2-butoxy-2-oxoethyl)carbamoyl]-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 66640921 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl 3-[(2-butoxy-2-oxoethyl)carbamoyl]-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | CCCCOC(=O)CNC(=O)N1C=C(C(=O)OCC)c2[nH]c3ccccc3c2CC1 |
| InChI | InChI=1S/C22H27N3O5/c1-3-5-12-30-19(26)13-23-22(28)25-11-10-16-15-8-6-7-9-18(15)24-20(16)17(14-25)21(27)29-4-2/h6-9,14,24H,3-5,10-13H2,1-2H3,(H,23,28) |
| InChIKey | QNTMUUQQYPSFNP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|