C27H29N3O5 — CID 68766164
ethyl 3-[butoxycarbonyl(phenyl)carbamoyl]-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 68766164) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is ethyl 3-[butoxycarbonyl(phenyl)carbamoyl]-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | ethyl 3-[butoxycarbonyl(phenyl)carbamoyl]-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 68766164 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | ethyl 3-[butoxycarbonyl(phenyl)carbamoyl]-2,6-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | CCCCOC(=O)N(C(=O)N1C=C(C(=O)OCC)c2[nH]c3ccccc3c2CC1)c1ccccc1 |
| InChI | InChI=1S/C27H29N3O5/c1-3-5-17-35-27(33)30(19-11-7-6-8-12-19)26(32)29-16-15-21-20-13-9-10-14-23(20)28-24(21)22(18-29)25(31)34-4-2/h6-14,18,28H,3-5,15-17H2,1-2H3 |
| InChIKey | AGGJIDHOAZGHSI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|