C31H31F3N4O4 — CID 66644578
(2S)-N-[3,4-dioxo-1-phenyl-4-(3-pyridin-2-ylpropylamino)butan-2-yl]-5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 66644578) has the molecular formula C31H31F3N4O4 and a molecular weight of 580.61 g/mol. Its IUPAC name is (2S)-N-[3,4-dioxo-1-phenyl-4-(3-pyridin-2-ylpropylamino)butan-2-yl]-5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3,4-dioxo-1-phenyl-4-(3-pyridin-2-ylpropylamino)butan-2-yl]-5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 66644578 |
| Molecular Formula | C31H31F3N4O4 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | (2S)-N-[3,4-dioxo-1-phenyl-4-(3-pyridin-2-ylpropylamino)butan-2-yl]-5-oxo-1-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccn1)C(=O)C(Cc1ccccc1)NC(=O)[C@@H]1CCC(=O)N1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C31H31F3N4O4/c32-31(33,34)24-14-5-4-11-22(24)20-38-26(15-16-27(38)39)29(41)37-25(19-21-9-2-1-3-10-21)28(40)30(42)36-18-8-13-23-12-6-7-17-35-23/h1-7,9-12,14,17,25-26H,8,13,15-16,18-20H2,(H,36,42)(H,37,41)/t25?,26-/m0/s1 |
| InChIKey | WFOVTAIFXLYWTP-AMVUTOCUSA-N |
| XLogP | 3.64 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|