C21H34N2O4 — CID 66645627
tert-butyl 4-[2-(3-methoxypropoxy)phenyl]-2,2-dimethylpiperazine-1-carboxylate (PubChem CID 66645627) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-methoxypropoxy)phenyl]-2,2-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-methoxypropoxy)phenyl]-2,2-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 66645627 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | tert-butyl 4-[2-(3-methoxypropoxy)phenyl]-2,2-dimethylpiperazine-1-carboxylate |
| SMILES | COCCCOc1ccccc1N1CCN(C(=O)OC(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C21H34N2O4/c1-20(2,3)27-19(24)23-13-12-22(16-21(23,4)5)17-10-7-8-11-18(17)26-15-9-14-25-6/h7-8,10-11H,9,12-16H2,1-6H3 |
| InChIKey | WAJXXLCQIJIXHJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|