C29H44ClFN4O7 — CID 66645980
(2S,4S,5S)-5-amino-N-butyl-6-[4-(2-chloro-5-fluorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-2-propan-2-ylhexanamide;but-2-enedioic acid (PubChem CID 66645980) has the molecular formula C29H44ClFN4O7 and a molecular weight of 615.14 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-N-butyl-6-[4-(2-chloro-5-fluorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-2-propan-2-ylhexanamide;but-2-enedioic acid.
| Compound Name | (2S,4S,5S)-5-amino-N-butyl-6-[4-(2-chloro-5-fluorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-2-propan-2-ylhexanamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 66645980 |
| Molecular Formula | C29H44ClFN4O7 |
| Molecular Weight | 615.14 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | (2S,4S,5S)-5-amino-N-butyl-6-[4-(2-chloro-5-fluorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-2-propan-2-ylhexanamide;but-2-enedioic acid |
| SMILES | CCCCNC(=O)C(C[C@H](O)[C@@H](N)CN1CC(=O)N(c2cc(F)ccc2Cl)CC1(C)C)C(C)C.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C25H40ClFN4O3.C4H4O4/c1-6-7-10-29-24(34)18(16(2)3)12-22(32)20(28)13-30-14-23(33)31(15-25(30,4)5)21-11-17(27)8-9-19(21)26;5-3(6)1-2-4(7)8/h8-9,11,16,18,20,22,32H,6-7,10,12-15,28H2,1-5H3,(H,29,34);1-2H,(H,5,6)(H,7,8)/t18?,20-,22-;/m0./s1 |
| InChIKey | NFMHTCYEKYYWDD-WSUHIVFNSA-N |
| XLogP | 2.88 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.14 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|