C29H45ClN4O8 — CID 73352002
(2R,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-2-ethyl-4-hydroxy-N-(3-hydroxy-2,2-dimethylpropyl)hexanamide;(E)-but-2-enedioic acid (PubChem CID 73352002) has the molecular formula C29H45ClN4O8 and a molecular weight of 613.15 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-2-ethyl-4-hydroxy-N-(3-hydroxy-2,2-dimethylpropyl)hexanamide;(E)-but-2-enedioic acid.
| Compound Name | (2R,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-2-ethyl-4-hydroxy-N-(3-hydroxy-2,2-dimethylpropyl)hexanamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 73352002 |
| Molecular Formula | C29H45ClN4O8 |
| Molecular Weight | 613.15 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | (2R,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-2-ethyl-4-hydroxy-N-(3-hydroxy-2,2-dimethylpropyl)hexanamide;(E)-but-2-enedioic acid |
| SMILES | CCC(C[C@H](O)[C@@H](N)CN1CC(=O)N(c2ccccc2Cl)CC1(C)C)C(=O)NCC(C)(C)CO.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C25H41ClN4O4.C4H4O4/c1-6-17(23(34)28-14-24(2,3)16-31)11-21(32)19(27)12-29-13-22(33)30(15-25(29,4)5)20-10-8-7-9-18(20)26;5-3(6)1-2-4(7)8/h7-10,17,19,21,31-32H,6,11-16,27H2,1-5H3,(H,28,34);1-2H,(H,5,6)(H,7,8)/b;2-1+/t17?,19-,21-;/m0./s1 |
| InChIKey | AKPKEPNKGHGDBE-NWSRIHJLSA-N |
| XLogP | 1.72 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|