C35H51ClN4O8 — CID 73350488
(2S,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-N-(3-hydroxy-1-adamantyl)-2-propan-2-ylhexanamide;(E)-but-2-enedioic acid (PubChem CID 73350488) has the molecular formula C35H51ClN4O8 and a molecular weight of 691.27 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-N-(3-hydroxy-1-adamantyl)-2-propan-2-ylhexanamide;(E)-but-2-enedioic acid.
| Compound Name | (2S,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-N-(3-hydroxy-1-adamantyl)-2-propan-2-ylhexanamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 73350488 |
| Molecular Formula | C35H51ClN4O8 |
| Molecular Weight | 691.27 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | (2S,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-N-(3-hydroxy-1-adamantyl)-2-propan-2-ylhexanamide;(E)-but-2-enedioic acid |
| SMILES | CC(C)[C@H](C[C@H](O)[C@@H](N)CN1CC(=O)N(c2ccccc2Cl)CC1(C)C)C(=O)NC12CC3CC(CC(O)(C3)C1)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C31H47ClN4O4.C4H4O4/c1-19(2)22(28(39)34-30-11-20-9-21(12-30)14-31(40,13-20)17-30)10-26(37)24(33)15-35-16-27(38)36(18-29(35,3)4)25-8-6-5-7-23(25)32;5-3(6)1-2-4(7)8/h5-8,19-22,24,26,37,40H,9-18,33H2,1-4H3,(H,34,39);1-2H,(H,5,6)(H,7,8)/b;2-1+/t20?,21?,22-,24-,26-,30?,31?;/m0./s1 |
| InChIKey | JKYRXOBVAYWQBX-CKYBPGCBSA-N |
| XLogP | 3.03 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|