C32H41ClN4O6 — CID 71462970
(E)-but-2-enedioic acid;(3S,5R)-5-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-N-[(1R)-1-phenylbutyl]piperidine-3-carboxamide (PubChem CID 71462970) has the molecular formula C32H41ClN4O6 and a molecular weight of 613.16 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3S,5R)-5-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-N-[(1R)-1-phenylbutyl]piperidine-3-carboxamide.
| Compound Name | (E)-but-2-enedioic acid;(3S,5R)-5-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-N-[(1R)-1-phenylbutyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 71462970 |
| Molecular Formula | C32H41ClN4O6 |
| Molecular Weight | 613.16 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | (E)-but-2-enedioic acid;(3S,5R)-5-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-N-[(1R)-1-phenylbutyl]piperidine-3-carboxamide |
| SMILES | CCC[C@@H](NC(=O)[C@@H]1CNC[C@H](N2CC(=O)N(c3ccccc3Cl)CC2(C)C)C1)c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H37ClN4O2.C4H4O4/c1-4-10-24(20-11-6-5-7-12-20)31-27(35)21-15-22(17-30-16-21)33-18-26(34)32(19-28(33,2)3)25-14-9-8-13-23(25)29;5-3(6)1-2-4(7)8/h5-9,11-14,21-22,24,30H,4,10,15-19H2,1-3H3,(H,31,35);1-2H,(H,5,6)(H,7,8)/b;2-1+/t21-,22+,24+;/m0./s1 |
| InChIKey | NJDDJHQFDIFPMB-HLOXRVNSSA-N |
| XLogP | 4.11 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.16 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|