C34H49ClN4O8 — CID 73347390
(2R,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-2-ethyl-4-hydroxy-N-(5-hydroxy-2-adamantyl)hexanamide;(E)-but-2-enedioic acid (PubChem CID 73347390) has the molecular formula C34H49ClN4O8 and a molecular weight of 677.24 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-2-ethyl-4-hydroxy-N-(5-hydroxy-2-adamantyl)hexanamide;(E)-but-2-enedioic acid.
| Compound Name | (2R,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-2-ethyl-4-hydroxy-N-(5-hydroxy-2-adamantyl)hexanamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 73347390 |
| Molecular Formula | C34H49ClN4O8 |
| Molecular Weight | 677.24 g/mol |
| Exact Mass | 676.32 |
| IUPAC Name | (2R,4S,5S)-5-amino-6-[4-(2-chlorophenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-2-ethyl-4-hydroxy-N-(5-hydroxy-2-adamantyl)hexanamide;(E)-but-2-enedioic acid |
| SMILES | CC[C@H](C[C@H](O)[C@@H](N)CN1CC(=O)N(c2ccccc2Cl)CC1(C)C)C(=O)NC1C2CC3CC1CC(O)(C3)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C30H45ClN4O4.C4H4O4/c1-4-19(28(38)33-27-20-9-18-10-21(27)14-30(39,12-18)13-20)11-25(36)23(32)15-34-16-26(37)35(17-29(34,2)3)24-8-6-5-7-22(24)31;5-3(6)1-2-4(7)8/h5-8,18-21,23,25,27,36,39H,4,9-17,32H2,1-3H3,(H,33,38);1-2H,(H,5,6)(H,7,8)/b;2-1+/t18?,19-,20?,21?,23+,25+,27?,30?;/m1./s1 |
| InChIKey | KLVCBVLNAFDACD-VGBQBAOCSA-N |
| XLogP | 2.64 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|