C15H19NO5S — CID 66654999
3-methoxy-2-[[2-methoxycarbonyl-5-(3-methylbut-1-ynyl)thiophen-3-yl]amino]propanoic acid (PubChem CID 66654999) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-methoxy-2-[[2-methoxycarbonyl-5-(3-methylbut-1-ynyl)thiophen-3-yl]amino]propanoic acid.
| Compound Name | 3-methoxy-2-[[2-methoxycarbonyl-5-(3-methylbut-1-ynyl)thiophen-3-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 66654999 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-methoxy-2-[[2-methoxycarbonyl-5-(3-methylbut-1-ynyl)thiophen-3-yl]amino]propanoic acid |
| SMILES | COCC(Nc1cc(C#CC(C)C)sc1C(=O)OC)C(=O)O |
| InChI | InChI=1S/C15H19NO5S/c1-9(2)5-6-10-7-11(13(22-10)15(19)21-4)16-12(8-20-3)14(17)18/h7,9,12,16H,8H2,1-4H3,(H,17,18) |
| InChIKey | VHQBYZQTTFUCJV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|