C24H23N5O4 — CID 66658032
N-[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-4-methoxybenzamide (PubChem CID 66658032) has the molecular formula C24H23N5O4 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-4-methoxybenzamide.
| Compound Name | N-[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 66658032 |
| Molecular Formula | C24H23N5O4 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(c2ccccc2)C(O)C(=O)N(N)c2ccc3nc[nH]c3c2)cc1 |
| InChI | InChI=1S/C24H23N5O4/c1-33-18-10-7-16(8-11-18)23(31)28-21(15-5-3-2-4-6-15)22(30)24(32)29(25)17-9-12-19-20(13-17)27-14-26-19/h2-14,21-22,30H,25H2,1H3,(H,26,27)(H,28,31) |
| InChIKey | QHWZKFUZJZOXNQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|