C25H22F3N5O4 — CID 66658536
N-[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 66658536) has the molecular formula C25H22F3N5O4 and a molecular weight of 513.48 g/mol. Its IUPAC name is N-[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 66658536 |
| Molecular Formula | C25H22F3N5O4 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-[3-[amino(3H-benzimidazol-5-yl)amino]-2-hydroxy-3-oxo-1-phenylpropyl]-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | NN(C(=O)C(O)C(NC(=O)c1ccc(OCC(F)(F)F)cc1)c1ccccc1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C25H22F3N5O4/c26-25(27,28)13-37-18-9-6-16(7-10-18)23(35)32-21(15-4-2-1-3-5-15)22(34)24(36)33(29)17-8-11-19-20(12-17)31-14-30-19/h1-12,14,21-22,34H,13,29H2,(H,30,31)(H,32,35) |
| InChIKey | CFOQURSBKHDGOU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 133.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|