C37H27NO2 — CID 66661911
benzhydrylbenzene;2-quinolin-2-ylindene-1,3-dione (PubChem CID 66661911) has the molecular formula C37H27NO2 and a molecular weight of 517.63 g/mol. Its IUPAC name is benzhydrylbenzene;2-quinolin-2-ylindene-1,3-dione.
| Compound Name | benzhydrylbenzene;2-quinolin-2-ylindene-1,3-dione |
|---|---|
| PubChem CID | 66661911 |
| Molecular Formula | C37H27NO2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | benzhydrylbenzene;2-quinolin-2-ylindene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1c1ccc2ccccc2n1.c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16.C18H11NO2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;20-17-12-6-2-3-7-13(12)18(21)16(17)15-10-9-11-5-1-4-8-14(11)19-15/h1-15,19H;1-10,16H |
| InChIKey | IFQACSFFKSZACB-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|