C24H17NO3 — CID 4090872
2-(6-ethoxyquinolin-2-yl)phenalene-1,3-dione (PubChem CID 4090872) has the molecular formula C24H17NO3 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-(6-ethoxyquinolin-2-yl)phenalene-1,3-dione.
| Compound Name | 2-(6-ethoxyquinolin-2-yl)phenalene-1,3-dione |
|---|---|
| PubChem CID | 4090872 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-(6-ethoxyquinolin-2-yl)phenalene-1,3-dione |
| SMILES | CCOc1ccc2nc(C3C(=O)c4cccc5cccc(c45)C3=O)ccc2c1 |
| InChI | InChI=1S/C24H17NO3/c1-2-28-16-10-12-19-15(13-16)9-11-20(25-19)22-23(26)17-7-3-5-14-6-4-8-18(21(14)17)24(22)27/h3-13,22H,2H2,1H3 |
| InChIKey | SYNMWOFXXNIKKX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|