C19H14NNaO5S — CID 175667579
sodium;methanesulfonate;2-quinolin-2-ylindene-1,3-dione (PubChem CID 175667579) has the molecular formula C19H14NNaO5S and a molecular weight of 391.38 g/mol. Its IUPAC name is sodium;methanesulfonate;2-quinolin-2-ylindene-1,3-dione.
| Compound Name | sodium;methanesulfonate;2-quinolin-2-ylindene-1,3-dione |
|---|---|
| PubChem CID | 175667579 |
| Molecular Formula | C19H14NNaO5S |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | sodium;methanesulfonate;2-quinolin-2-ylindene-1,3-dione |
| SMILES | CS(=O)(=O)[O-].O=C1c2ccccc2C(=O)C1c1ccc2ccccc2n1.[Na+] |
| InChI | InChI=1S/C18H11NO2.CH4O3S.Na/c20-17-12-6-2-3-7-13(12)18(21)16(17)15-10-9-11-5-1-4-8-14(11)19-15;1-5(2,3)4;/h1-10,16H;1H3,(H,2,3,4);/q;;+1/p-1 |
| InChIKey | JFQVNBGKMDOPHU-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 104.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|