C40H36N2O2 — CID 66663727
6-[5-[bis(1-phenylpropyl)carbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide (PubChem CID 66663727) has the molecular formula C40H36N2O2 and a molecular weight of 576.74 g/mol. Its IUPAC name is 6-[5-[bis(1-phenylpropyl)carbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide.
| Compound Name | 6-[5-[bis(1-phenylpropyl)carbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 66663727 |
| Molecular Formula | C40H36N2O2 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 6-[5-[bis(1-phenylpropyl)carbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide |
| SMILES | CCC(c1ccccc1)N(C(=O)c1cccc2cc(-c3ccc4c(C(N)=O)cccc4c3)ccc12)C(CC)c1ccccc1 |
| InChI | InChI=1S/C40H36N2O2/c1-3-37(27-13-7-5-8-14-27)42(38(4-2)28-15-9-6-10-16-28)40(44)36-20-12-18-32-26-30(22-24-34(32)36)29-21-23-33-31(25-29)17-11-19-35(33)39(41)43/h5-26,37-38H,3-4H2,1-2H3,(H2,41,43) |
| InChIKey | SBQGWJVHJXCELF-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |