C31H26N2O2 — CID 140573292
6-(5-carbamoylnaphthalen-2-yl)-5-[(2R)-2-phenylpropyl]naphthalene-1-carboxamide (PubChem CID 140573292) has the molecular formula C31H26N2O2 and a molecular weight of 458.56 g/mol. Its IUPAC name is 6-(5-carbamoylnaphthalen-2-yl)-5-[(2R)-2-phenylpropyl]naphthalene-1-carboxamide.
| Compound Name | 6-(5-carbamoylnaphthalen-2-yl)-5-[(2R)-2-phenylpropyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140573292 |
| Molecular Formula | C31H26N2O2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 6-(5-carbamoylnaphthalen-2-yl)-5-[(2R)-2-phenylpropyl]naphthalene-1-carboxamide |
| SMILES | C[C@H](Cc1c(-c2ccc3c(C(N)=O)cccc3c2)ccc2c(C(N)=O)cccc12)c1ccccc1 |
| InChI | InChI=1S/C31H26N2O2/c1-19(20-7-3-2-4-8-20)17-29-24(15-16-26-25(29)10-6-12-28(26)31(33)35)22-13-14-23-21(18-22)9-5-11-27(23)30(32)34/h2-16,18-19H,17H2,1H3,(H2,32,34)(H2,33,35)/t19-/m1/s1 |
| InChIKey | HHBQVYDBKBCFLS-LJQANCHMSA-N |
| XLogP | 6.20 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |