C20H19ClN4O3S2 — CID 66664271
N-[4-[2-[3-(aminomethyl)phenyl]ethoxy]-1H-indazol-3-yl]-5-chlorothiophene-2-sulfonamide (PubChem CID 66664271) has the molecular formula C20H19ClN4O3S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is N-[4-[2-[3-(aminomethyl)phenyl]ethoxy]-1H-indazol-3-yl]-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-[4-[2-[3-(aminomethyl)phenyl]ethoxy]-1H-indazol-3-yl]-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66664271 |
| Molecular Formula | C20H19ClN4O3S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-[4-[2-[3-(aminomethyl)phenyl]ethoxy]-1H-indazol-3-yl]-5-chlorothiophene-2-sulfonamide |
| SMILES | NCc1cccc(CCOc2cccc3[nH]nc(NS(=O)(=O)c4ccc(Cl)s4)c23)c1 |
| InChI | InChI=1S/C20H19ClN4O3S2/c21-17-7-8-18(29-17)30(26,27)25-20-19-15(23-24-20)5-2-6-16(19)28-10-9-13-3-1-4-14(11-13)12-22/h1-8,11H,9-10,12,22H2,(H2,23,24,25) |
| InChIKey | RUWPEJDQONKIQI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |