C21H21FN4O4S — CID 66664473
5-(4-fluorophenyl)-N-methyl-10-methylidene-15-methylsulfonyl-4-oxa-2,12,15-triazatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7-tetraene-6-carboxamide (PubChem CID 66664473) has the molecular formula C21H21FN4O4S and a molecular weight of 444.49 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-methyl-10-methylidene-15-methylsulfonyl-4-oxa-2,12,15-triazatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7-tetraene-6-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-methyl-10-methylidene-15-methylsulfonyl-4-oxa-2,12,15-triazatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 66664473 |
| Molecular Formula | C21H21FN4O4S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 5-(4-fluorophenyl)-N-methyl-10-methylidene-15-methylsulfonyl-4-oxa-2,12,15-triazatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7-tetraene-6-carboxamide |
| SMILES | C=C1CNCCN(S(C)(=O)=O)c2nc3oc(-c4ccc(F)cc4)c(C(=O)NC)c3cc21 |
| InChI | InChI=1S/C21H21FN4O4S/c1-12-11-24-8-9-26(31(3,28)29)19-15(12)10-16-17(20(27)23-2)18(30-21(16)25-19)13-4-6-14(22)7-5-13/h4-7,10,24H,1,8-9,11H2,2-3H3,(H,23,27) |
| InChIKey | VXJGNYQIEQGVAL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |