C32H31NO5S — CID 6666487
(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-3-prop-2-enylphenyl)-6a,8-dimethyl-2-(thiophen-2-ylmethyl)-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6666487) has the molecular formula C32H31NO5S and a molecular weight of 541.67 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-3-prop-2-enylphenyl)-6a,8-dimethyl-2-(thiophen-2-ylmethyl)-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-3-prop-2-enylphenyl)-6a,8-dimethyl-2-(thiophen-2-ylmethyl)-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6666487 |
| Molecular Formula | C32H31NO5S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-3-prop-2-enylphenyl)-6a,8-dimethyl-2-(thiophen-2-ylmethyl)-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | C=CCc1cccc([C@H]2C3=CC[C@@H]4C(=O)N(Cc5cccs5)C(=O)[C@@H]4[C@@H]3C[C@H]3C(=O)C=C(C)C(=O)[C@@]23C)c1O |
| InChI | InChI=1S/C32H31NO5S/c1-4-7-18-8-5-10-22(28(18)35)27-20-11-12-21-26(31(38)33(30(21)37)16-19-9-6-13-39-19)23(20)15-24-25(34)14-17(2)29(36)32(24,27)3/h4-6,8-11,13-14,21,23-24,26-27,35H,1,7,12,15-16H2,2-3H3/t21-,23+,24-,26-,27+,32+/m0/s1 |
| InChIKey | PDHVHDFEOBWXFL-OOMPXMEMSA-N |
| XLogP | 5.14 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|