C38H41Cl2F2N3O3 — CID 66666113
4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-(2-cyano-2-cyclohexylethyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]benzoic acid (PubChem CID 66666113) has the molecular formula C38H41Cl2F2N3O3 and a molecular weight of 696.67 g/mol. Its IUPAC name is 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-(2-cyano-2-cyclohexylethyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-(2-cyano-2-cyclohexylethyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 66666113 |
| Molecular Formula | C38H41Cl2F2N3O3 |
| Molecular Weight | 696.67 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-(2-cyano-2-cyclohexylethyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]benzoic acid |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)Nc2ccc(C(=O)O)cc2)[C@H](c2cccc(Cl)c2F)[C@]1(CC(C#N)C1CCCCC1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C38H41Cl2F2N3O3/c1-37(2,3)20-31-38(28-17-14-25(39)18-30(28)41,19-24(21-43)22-8-5-4-6-9-22)32(27-10-7-11-29(40)33(27)42)34(45-31)35(46)44-26-15-12-23(13-16-26)36(47)48/h7,10-18,22,24,31-32,34,45H,4-6,8-9,19-20H2,1-3H3,(H,44,46)(H,47,48)/t24?,31-,32-,34+,38+/m0/s1 |
| InChIKey | BKRKXBZLNLKHHL-WPXMRROJSA-N |
| XLogP | 9.52 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.67 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |