C19H22ClN5O3 — CID 66666944
N-(3-chlorophenyl)-2-[2-(cyclopropylamino)-2-oxoethyl]-3-oxo-6,7,8,9-tetrahydro-4H-pyrido[2,1-c][1,2,4]triazine-7-carboxamide (PubChem CID 66666944) has the molecular formula C19H22ClN5O3 and a molecular weight of 403.87 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2-(cyclopropylamino)-2-oxoethyl]-3-oxo-6,7,8,9-tetrahydro-4H-pyrido[2,1-c][1,2,4]triazine-7-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2-[2-(cyclopropylamino)-2-oxoethyl]-3-oxo-6,7,8,9-tetrahydro-4H-pyrido[2,1-c][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 66666944 |
| Molecular Formula | C19H22ClN5O3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2-(cyclopropylamino)-2-oxoethyl]-3-oxo-6,7,8,9-tetrahydro-4H-pyrido[2,1-c][1,2,4]triazine-7-carboxamide |
| SMILES | O=C(CN1N=C2CCC(C(=O)Nc3cccc(Cl)c3)CN2CC1=O)NC1CC1 |
| InChI | InChI=1S/C19H22ClN5O3/c20-13-2-1-3-15(8-13)22-19(28)12-4-7-16-23-25(18(27)11-24(16)9-12)10-17(26)21-14-5-6-14/h1-3,8,12,14H,4-7,9-11H2,(H,21,26)(H,22,28) |
| InChIKey | WVLHSWMYGVXRHP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |