C16H13NO3 — CID 66667210
prop-2-enyl 7-hydroxypyrido[1,2-a]indole-10-carboxylate (PubChem CID 66667210) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is prop-2-enyl 7-hydroxypyrido[1,2-a]indole-10-carboxylate.
| Compound Name | prop-2-enyl 7-hydroxypyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 66667210 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | prop-2-enyl 7-hydroxypyrido[1,2-a]indole-10-carboxylate |
| SMILES | C=CCOC(=O)c1c2ccccc2n2cc(O)ccc12 |
| InChI | InChI=1S/C16H13NO3/c1-2-9-20-16(19)15-12-5-3-4-6-13(12)17-10-11(18)7-8-14(15)17/h2-8,10,18H,1,9H2 |
| InChIKey | GUIMZKDVYQLIDU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|