C18H20N2O4S — CID 87097296
N,N-dimethyl-2-(7-methylsulfinylpyrido[1,2-a]indole-10-carbonyl)oxyethanamine oxide (PubChem CID 87097296) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N,N-dimethyl-2-(7-methylsulfinylpyrido[1,2-a]indole-10-carbonyl)oxyethanamine oxide.
| Compound Name | N,N-dimethyl-2-(7-methylsulfinylpyrido[1,2-a]indole-10-carbonyl)oxyethanamine oxide |
|---|---|
| PubChem CID | 87097296 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N,N-dimethyl-2-(7-methylsulfinylpyrido[1,2-a]indole-10-carbonyl)oxyethanamine oxide |
| SMILES | CS(=O)c1ccc2c(C(=O)OCC[N+](C)(C)[O-])c3ccccc3n2c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-20(2,22)10-11-24-18(21)17-14-6-4-5-7-15(14)19-12-13(25(3)23)8-9-16(17)19/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | GCJSFLHGHOSFHI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|