C16H14ClNO3S — CID 66667495
methyl 7-(2-chloroethylsulfinyl)pyrido[1,2-a]indole-10-carboxylate (PubChem CID 66667495) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is methyl 7-(2-chloroethylsulfinyl)pyrido[1,2-a]indole-10-carboxylate.
| Compound Name | methyl 7-(2-chloroethylsulfinyl)pyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 66667495 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | methyl 7-(2-chloroethylsulfinyl)pyrido[1,2-a]indole-10-carboxylate |
| SMILES | COC(=O)c1c2ccccc2n2cc(S(=O)CCCl)ccc12 |
| InChI | InChI=1S/C16H14ClNO3S/c1-21-16(19)15-12-4-2-3-5-13(12)18-10-11(6-7-14(15)18)22(20)9-8-17/h2-7,10H,8-9H2,1H3 |
| InChIKey | CAEZPNDNPKIOFZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|