C12H11BN4O4S — CID 66668003
[1-(3-sulfamoylphenyl)pyrazolo[3,4-b]pyridin-4-yl]boronic acid (PubChem CID 66668003) has the molecular formula C12H11BN4O4S and a molecular weight of 318.12 g/mol. Its IUPAC name is [1-(3-sulfamoylphenyl)pyrazolo[3,4-b]pyridin-4-yl]boronic acid.
| Compound Name | [1-(3-sulfamoylphenyl)pyrazolo[3,4-b]pyridin-4-yl]boronic acid |
|---|---|
| PubChem CID | 66668003 |
| Molecular Formula | C12H11BN4O4S |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | [1-(3-sulfamoylphenyl)pyrazolo[3,4-b]pyridin-4-yl]boronic acid |
| SMILES | NS(=O)(=O)c1cccc(-n2ncc3c(B(O)O)ccnc32)c1 |
| InChI | InChI=1S/C12H11BN4O4S/c14-22(20,21)9-3-1-2-8(6-9)17-12-10(7-16-17)11(13(18)19)4-5-15-12/h1-7,18-19H,(H2,14,20,21) |
| InChIKey | LXHZJDXGFJDXQG-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|