About 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one
3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one (PubChem CID 66668245) has the molecular formula C22H20BrNO
and a molecular weight of 394.31 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one |
| PubChem CID | 66668245 |
| Molecular Formula | C22H20BrNO |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one |
| SMILES | Cc1cc(C(=O)C(Cc2ccc(Br)cc2)c2ccccc2)cc(C)n1 |
| InChI | InChI=1S/C22H20BrNO/c1-15-12-19(13-16(2)24-15)22(25)21(18-6-4-3-5-7-18)14-17-8-10-20(23)11-9-17/h3-13,21H,14H2,1-2H3 |
| InChIKey | JMQHNJIJHOXCHD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one?
The IUPAC name of 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one (CID 66668245) is 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one.
What is the SMILES notation for 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one?
The canonical SMILES for 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one is Cc1cc(C(=O)C(Cc2ccc(Br)cc2)c2ccccc2)cc(C)n1.
What is the InChIKey of 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one?
The InChIKey is JMQHNJIJHOXCHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20BrNO/c1-15-12-19(13-16(2)24-15)22(25)21(18-6-4-3-5-7-18)14-17-8-10-20(23)11-9-17/h3-13,21H,14H2,1-2H3.
What are the key properties of 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one?
3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one has a molecular weight of 394.31 g/mol, XLogP of 5.67, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-1-(2,6-dimethyl-4-pyridinyl)-2-phenylpropan-1-one is sourced from PubChem (CID 66668245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).