C32H50N6O2 — CID 66669060
3,6-bis[4-[(5-butyl-2-pyridinyl)methylamino]butyl]piperazine-2,5-dione (PubChem CID 66669060) has the molecular formula C32H50N6O2 and a molecular weight of 550.79 g/mol. Its IUPAC name is 3,6-bis[4-[(5-butyl-2-pyridinyl)methylamino]butyl]piperazine-2,5-dione.
| Compound Name | 3,6-bis[4-[(5-butyl-2-pyridinyl)methylamino]butyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 66669060 |
| Molecular Formula | C32H50N6O2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | 3,6-bis[4-[(5-butyl-2-pyridinyl)methylamino]butyl]piperazine-2,5-dione |
| SMILES | CCCCc1ccc(CNCCCCC2NC(=O)C(CCCCNCc3ccc(CCCC)cn3)NC2=O)nc1 |
| InChI | InChI=1S/C32H50N6O2/c1-3-5-11-25-15-17-27(35-21-25)23-33-19-9-7-13-29-31(39)38-30(32(40)37-29)14-8-10-20-34-24-28-18-16-26(22-36-28)12-6-4-2/h15-18,21-22,29-30,33-34H,3-14,19-20,23-24H2,1-2H3,(H,37,40)(H,38,39) |
| InChIKey | BRMJTBSJIQCZPN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|