C13H15ClF3NO2 — CID 66670220
N-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]oxan-4-amine (PubChem CID 66670220) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.72 g/mol. Its IUPAC name is N-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]oxan-4-amine.
| Compound Name | N-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]oxan-4-amine |
|---|---|
| PubChem CID | 66670220 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[[4-chloro-3-(trifluoromethoxy)phenyl]methyl]oxan-4-amine |
| SMILES | FC(F)(F)Oc1cc(CNC2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C13H15ClF3NO2/c14-11-2-1-9(7-12(11)20-13(15,16)17)8-18-10-3-5-19-6-4-10/h1-2,7,10,18H,3-6,8H2 |
| InChIKey | UOHJMTGVRFPKFH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |