C21H20ClNO3 — CID 66680000
methyl 5-chloro-2-[[3-(cyclohexen-1-yl)benzoyl]amino]benzoate (PubChem CID 66680000) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is methyl 5-chloro-2-[[3-(cyclohexen-1-yl)benzoyl]amino]benzoate.
| Compound Name | methyl 5-chloro-2-[[3-(cyclohexen-1-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 66680000 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | methyl 5-chloro-2-[[3-(cyclohexen-1-yl)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC(=O)c1cccc(C2=CCCCC2)c1 |
| InChI | InChI=1S/C21H20ClNO3/c1-26-21(25)18-13-17(22)10-11-19(18)23-20(24)16-9-5-8-15(12-16)14-6-3-2-4-7-14/h5-6,8-13H,2-4,7H2,1H3,(H,23,24) |
| InChIKey | ODLROPNRPPNEKZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |