C25H22FNO2 — CID 66683915
2-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-4-(pyridin-2-ylmethyl)cyclopentane-1,3-dione (PubChem CID 66683915) has the molecular formula C25H22FNO2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-4-(pyridin-2-ylmethyl)cyclopentane-1,3-dione.
| Compound Name | 2-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-4-(pyridin-2-ylmethyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 66683915 |
| Molecular Formula | C25H22FNO2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-4-(pyridin-2-ylmethyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ccc(F)cc2)cc(C)c1C1C(=O)CC(Cc2ccccn2)C1=O |
| InChI | InChI=1S/C25H22FNO2/c1-15-11-18(17-6-8-20(26)9-7-17)12-16(2)23(15)24-22(28)14-19(25(24)29)13-21-5-3-4-10-27-21/h3-12,19,24H,13-14H2,1-2H3 |
| InChIKey | XIWUXAVSUFXMJW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|