C29H26FNO3 — CID 162502310
2-benzoyl-7-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-2-azaspiro[3.5]nonane-6,8-dione (PubChem CID 162502310) has the molecular formula C29H26FNO3 and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-benzoyl-7-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-2-azaspiro[3.5]nonane-6,8-dione.
| Compound Name | 2-benzoyl-7-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-2-azaspiro[3.5]nonane-6,8-dione |
|---|---|
| PubChem CID | 162502310 |
| Molecular Formula | C29H26FNO3 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-benzoyl-7-[4-(4-fluorophenyl)-2,6-dimethylphenyl]-2-azaspiro[3.5]nonane-6,8-dione |
| SMILES | Cc1cc(-c2ccc(F)cc2)cc(C)c1C1C(=O)CC2(CC1=O)CN(C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C29H26FNO3/c1-18-12-22(20-8-10-23(30)11-9-20)13-19(2)26(18)27-24(32)14-29(15-25(27)33)16-31(17-29)28(34)21-6-4-3-5-7-21/h3-13,27H,14-17H2,1-2H3 |
| InChIKey | RGBJXGUEZCDNGQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|