C26H29FN2O4 — CID 162502260
2-(2,2-dimethylpropanoyl)-7-[4-(5-fluoro-2-pyridinyl)-2-methoxy-6-methylphenyl]-2-azaspiro[3.5]nonane-6,8-dione (PubChem CID 162502260) has the molecular formula C26H29FN2O4 and a molecular weight of 452.53 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyl)-7-[4-(5-fluoro-2-pyridinyl)-2-methoxy-6-methylphenyl]-2-azaspiro[3.5]nonane-6,8-dione.
| Compound Name | 2-(2,2-dimethylpropanoyl)-7-[4-(5-fluoro-2-pyridinyl)-2-methoxy-6-methylphenyl]-2-azaspiro[3.5]nonane-6,8-dione |
|---|---|
| PubChem CID | 162502260 |
| Molecular Formula | C26H29FN2O4 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-(2,2-dimethylpropanoyl)-7-[4-(5-fluoro-2-pyridinyl)-2-methoxy-6-methylphenyl]-2-azaspiro[3.5]nonane-6,8-dione |
| SMILES | COc1cc(-c2ccc(F)cn2)cc(C)c1C1C(=O)CC2(CC1=O)CN(C(=O)C(C)(C)C)C2 |
| InChI | InChI=1S/C26H29FN2O4/c1-15-8-16(18-7-6-17(27)12-28-18)9-21(33-5)22(15)23-19(30)10-26(11-20(23)31)13-29(14-26)24(32)25(2,3)4/h6-9,12,23H,10-11,13-14H2,1-5H3 |
| InChIKey | VAKPOZBVKNLOGH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|