C30H38N2O4 — CID 155592172
tert-butyl N-[3-[2,6-dimethyl-4-(5-methyl-2-pyridinyl)phenyl]-2,4-dioxospiro[5.5]undecan-9-yl]carbamate (PubChem CID 155592172) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is tert-butyl N-[3-[2,6-dimethyl-4-(5-methyl-2-pyridinyl)phenyl]-2,4-dioxospiro[5.5]undecan-9-yl]carbamate.
| Compound Name | tert-butyl N-[3-[2,6-dimethyl-4-(5-methyl-2-pyridinyl)phenyl]-2,4-dioxospiro[5.5]undecan-9-yl]carbamate |
|---|---|
| PubChem CID | 155592172 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | tert-butyl N-[3-[2,6-dimethyl-4-(5-methyl-2-pyridinyl)phenyl]-2,4-dioxospiro[5.5]undecan-9-yl]carbamate |
| SMILES | Cc1ccc(-c2cc(C)c(C3C(=O)CC4(CCC(NC(=O)OC(C)(C)C)CC4)CC3=O)c(C)c2)nc1 |
| InChI | InChI=1S/C30H38N2O4/c1-18-7-8-23(31-17-18)21-13-19(2)26(20(3)14-21)27-24(33)15-30(16-25(27)34)11-9-22(10-12-30)32-28(35)36-29(4,5)6/h7-8,13-14,17,22,27H,9-12,15-16H2,1-6H3,(H,32,35) |
| InChIKey | NPQHBPZXYSLUSB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|