C20H28N6O3 — CID 153347673
tert-butyl N-[4-[[5-(2-methoxypyrimidin-5-yl)pyrazin-2-yl]amino]cyclohexyl]carbamate (PubChem CID 153347673) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-(2-methoxypyrimidin-5-yl)pyrazin-2-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-(2-methoxypyrimidin-5-yl)pyrazin-2-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 153347673 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | tert-butyl N-[4-[[5-(2-methoxypyrimidin-5-yl)pyrazin-2-yl]amino]cyclohexyl]carbamate |
| SMILES | COc1ncc(-c2cnc(NC3CCC(NC(=O)OC(C)(C)C)CC3)cn2)cn1 |
| InChI | InChI=1S/C20H28N6O3/c1-20(2,3)29-19(27)26-15-7-5-14(6-8-15)25-17-12-21-16(11-22-17)13-9-23-18(28-4)24-10-13/h9-12,14-15H,5-8H2,1-4H3,(H,22,25)(H,26,27) |
| InChIKey | JDEIAQKYMBCXDO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |