C26H30FNO3S — CID 170124513
3-ethylsulfanyl-9-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 170124513) has the molecular formula C26H30FNO3S and a molecular weight of 455.60 g/mol. Its IUPAC name is 3-ethylsulfanyl-9-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-ethylsulfanyl-9-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 170124513 |
| Molecular Formula | C26H30FNO3S |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-ethylsulfanyl-9-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CCSN1CCC2(CC1)CC(=O)C(c1c(C)cc(-c3ccc(F)cc3)cc1OC)C(=O)C2 |
| InChI | InChI=1S/C26H30FNO3S/c1-4-32-28-11-9-26(10-12-28)15-21(29)25(22(30)16-26)24-17(2)13-19(14-23(24)31-3)18-5-7-20(27)8-6-18/h5-8,13-14,25H,4,9-12,15-16H2,1-3H3 |
| InChIKey | CNGKTINZMDHRMB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|