C30H27ClFNO4 — CID 155576352
3-benzoyl-9-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 155576352) has the molecular formula C30H27ClFNO4 and a molecular weight of 520.00 g/mol. Its IUPAC name is 3-benzoyl-9-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-benzoyl-9-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 155576352 |
| Molecular Formula | C30H27ClFNO4 |
| Molecular Weight | 520.00 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 3-benzoyl-9-[2-chloro-4-(4-fluorophenyl)-6-methoxyphenyl]-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | COc1cc(-c2ccc(F)cc2)cc(Cl)c1C1C(=O)CC2(CCN(C(=O)c3ccccc3)CC2)CC1=O |
| InChI | InChI=1S/C30H27ClFNO4/c1-37-26-16-21(19-7-9-22(32)10-8-19)15-23(31)27(26)28-24(34)17-30(18-25(28)35)11-13-33(14-12-30)29(36)20-5-3-2-4-6-20/h2-10,15-16,28H,11-14,17-18H2,1H3 |
| InChIKey | QVLRMBNLCWWUTC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.00 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|