C26H28FNO4 — CID 139492759
3-acetyl-9-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139492759) has the molecular formula C26H28FNO4 and a molecular weight of 437.51 g/mol. Its IUPAC name is 3-acetyl-9-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-acetyl-9-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139492759 |
| Molecular Formula | C26H28FNO4 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-acetyl-9-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | COc1cc(-c2ccc(F)cc2)cc(C)c1C1C(=O)CC2(CCN(C(C)=O)CC2)CC1=O |
| InChI | InChI=1S/C26H28FNO4/c1-16-12-19(18-4-6-20(27)7-5-18)13-23(32-3)24(16)25-21(30)14-26(15-22(25)31)8-10-28(11-9-26)17(2)29/h4-7,12-13,25H,8-11,14-15H2,1-3H3 |
| InChIKey | ZBIQZYKRNKGLJK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|