C21H27NO3 — CID 139492678
3-acetyl-9-(2,4,6-trimethylphenyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139492678) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 3-acetyl-9-(2,4,6-trimethylphenyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-acetyl-9-(2,4,6-trimethylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139492678 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 3-acetyl-9-(2,4,6-trimethylphenyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC(=O)N1CCC2(CC1)CC(=O)C(c1c(C)cc(C)cc1C)C(=O)C2 |
| InChI | InChI=1S/C21H27NO3/c1-13-9-14(2)19(15(3)10-13)20-17(24)11-21(12-18(20)25)5-7-22(8-6-21)16(4)23/h9-10,20H,5-8,11-12H2,1-4H3 |
| InChIKey | HYVMPQUQEVRQBH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|