C25H27ClN2O3 — CID 139492684
3-acetyl-9-[4-(5-chloro-2-pyridinyl)-2,6-dimethylphenyl]-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 139492684) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is 3-acetyl-9-[4-(5-chloro-2-pyridinyl)-2,6-dimethylphenyl]-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 3-acetyl-9-[4-(5-chloro-2-pyridinyl)-2,6-dimethylphenyl]-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 139492684 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-acetyl-9-[4-(5-chloro-2-pyridinyl)-2,6-dimethylphenyl]-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC(=O)N1CCC2(CC1)CC(=O)C(c1c(C)cc(-c3ccc(Cl)cn3)cc1C)C(=O)C2 |
| InChI | InChI=1S/C25H27ClN2O3/c1-15-10-18(20-5-4-19(26)14-27-20)11-16(2)23(15)24-21(30)12-25(13-22(24)31)6-8-28(9-7-25)17(3)29/h4-5,10-11,14,24H,6-9,12-13H2,1-3H3 |
| InChIKey | CBPISTSWGWDTII-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|