C30H32N2O3 — CID 167637175
6-[4-[9-(2-cyclopropyl-2-oxoethyl)-2,4-dioxospiro[5.5]undecan-3-yl]-3,5-dimethylphenyl]pyridine-3-carbonitrile (PubChem CID 167637175) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 6-[4-[9-(2-cyclopropyl-2-oxoethyl)-2,4-dioxospiro[5.5]undecan-3-yl]-3,5-dimethylphenyl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[9-(2-cyclopropyl-2-oxoethyl)-2,4-dioxospiro[5.5]undecan-3-yl]-3,5-dimethylphenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167637175 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 6-[4-[9-(2-cyclopropyl-2-oxoethyl)-2,4-dioxospiro[5.5]undecan-3-yl]-3,5-dimethylphenyl]pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccc(C#N)cn2)cc(C)c1C1C(=O)CC2(CCC(CC(=O)C3CC3)CC2)CC1=O |
| InChI | InChI=1S/C30H32N2O3/c1-18-11-23(24-6-3-21(16-31)17-32-24)12-19(2)28(18)29-26(34)14-30(15-27(29)35)9-7-20(8-10-30)13-25(33)22-4-5-22/h3,6,11-12,17,20,22,29H,4-5,7-10,13-15H2,1-2H3 |
| InChIKey | OQJLHOFIYNKGAH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 87.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|