C26H27N3O4 — CID 162502329
6-[4-[2-(2-ethoxyacetyl)-6,8-dioxo-2-azaspiro[3.5]nonan-7-yl]-3,5-dimethylphenyl]pyridine-3-carbonitrile (PubChem CID 162502329) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 6-[4-[2-(2-ethoxyacetyl)-6,8-dioxo-2-azaspiro[3.5]nonan-7-yl]-3,5-dimethylphenyl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[2-(2-ethoxyacetyl)-6,8-dioxo-2-azaspiro[3.5]nonan-7-yl]-3,5-dimethylphenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162502329 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 6-[4-[2-(2-ethoxyacetyl)-6,8-dioxo-2-azaspiro[3.5]nonan-7-yl]-3,5-dimethylphenyl]pyridine-3-carbonitrile |
| SMILES | CCOCC(=O)N1CC2(CC(=O)C(c3c(C)cc(-c4ccc(C#N)cn4)cc3C)C(=O)C2)C1 |
| InChI | InChI=1S/C26H27N3O4/c1-4-33-13-23(32)29-14-26(15-29)9-21(30)25(22(31)10-26)24-16(2)7-19(8-17(24)3)20-6-5-18(11-27)12-28-20/h5-8,12,25H,4,9-10,13-15H2,1-3H3 |
| InChIKey | GWSRMMYFLDOICA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 100.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|