C26H29N3O4S — CID 139492769
6-[4-(3-ethylsulfonyl-8,10-dioxo-3-azaspiro[5.5]undecan-9-yl)-3,5-dimethylphenyl]pyridine-3-carbonitrile (PubChem CID 139492769) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is 6-[4-(3-ethylsulfonyl-8,10-dioxo-3-azaspiro[5.5]undecan-9-yl)-3,5-dimethylphenyl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(3-ethylsulfonyl-8,10-dioxo-3-azaspiro[5.5]undecan-9-yl)-3,5-dimethylphenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139492769 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 6-[4-(3-ethylsulfonyl-8,10-dioxo-3-azaspiro[5.5]undecan-9-yl)-3,5-dimethylphenyl]pyridine-3-carbonitrile |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)CC(=O)C(c1c(C)cc(-c3ccc(C#N)cn3)cc1C)C(=O)C2 |
| InChI | InChI=1S/C26H29N3O4S/c1-4-34(32,33)29-9-7-26(8-10-29)13-22(30)25(23(31)14-26)24-17(2)11-20(12-18(24)3)21-6-5-19(15-27)16-28-21/h5-6,11-12,16,25H,4,7-10,13-14H2,1-3H3 |
| InChIKey | PHQJAZDZUKQYNP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 108.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|