C26H27FN2O5 — CID 162502227
7-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-2-[(2E)-2-methoxyiminopropanoyl]-2-azaspiro[3.5]nonane-6,8-dione (PubChem CID 162502227) has the molecular formula C26H27FN2O5 and a molecular weight of 466.51 g/mol. Its IUPAC name is 7-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-2-[(2E)-2-methoxyiminopropanoyl]-2-azaspiro[3.5]nonane-6,8-dione.
| Compound Name | 7-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-2-[(2E)-2-methoxyiminopropanoyl]-2-azaspiro[3.5]nonane-6,8-dione |
|---|---|
| PubChem CID | 162502227 |
| Molecular Formula | C26H27FN2O5 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 7-[4-(4-fluorophenyl)-2-methoxy-6-methylphenyl]-2-[(2E)-2-methoxyiminopropanoyl]-2-azaspiro[3.5]nonane-6,8-dione |
| SMILES | CO/N=C(\C)C(=O)N1CC2(CC(=O)C(c3c(C)cc(-c4ccc(F)cc4)cc3OC)C(=O)C2)C1 |
| InChI | InChI=1S/C26H27FN2O5/c1-15-9-18(17-5-7-19(27)8-6-17)10-22(33-3)23(15)24-20(30)11-26(12-21(24)31)13-29(14-26)25(32)16(2)28-34-4/h5-10,24H,11-14H2,1-4H3/b28-16+ |
| InChIKey | LKNAGTVLAUQFTJ-LQKURTRISA-N |
| XLogP | 3.68 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|