C27H22O12 — CID 66684696
[(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 2,3,4,6-tetrahydroxy-5-oxo-4a,9a-dihydrobenzo[7]annulene-8-carboxylate (PubChem CID 66684696) has the molecular formula C27H22O12 and a molecular weight of 538.46 g/mol. Its IUPAC name is [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 2,3,4,6-tetrahydroxy-5-oxo-4a,9a-dihydrobenzo[7]annulene-8-carboxylate.
| Compound Name | [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 2,3,4,6-tetrahydroxy-5-oxo-4a,9a-dihydrobenzo[7]annulene-8-carboxylate |
|---|---|
| PubChem CID | 66684696 |
| Molecular Formula | C27H22O12 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 2,3,4,6-tetrahydroxy-5-oxo-4a,9a-dihydrobenzo[7]annulene-8-carboxylate |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1)C1=CC2C=C(O)C(O)=C(O)C2C(=O)C(O)=C1 |
| InChI | InChI=1S/C27H22O12/c28-13-7-16(30)14-9-21(26(38-20(14)8-13)10-1-2-15(29)17(31)4-10)39-27(37)12-3-11-5-19(33)24(35)25(36)22(11)23(34)18(32)6-12/h1-8,11,21-22,26,28-33,35-36H,9H2/t11?,21-,22?,26-/m1/s1 |
| InChIKey | HOTWNBBIHLBPQZ-VTTFLKHZSA-N |
| XLogP | 3.06 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|