C17H29N3O6 — CID 66686056
1-O-tert-butyl 3-O-methyl 6-[(2-methylpropanoylamino)carbamoyl]piperidine-1,3-dicarboxylate (PubChem CID 66686056) has the molecular formula C17H29N3O6 and a molecular weight of 371.43 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 6-[(2-methylpropanoylamino)carbamoyl]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 6-[(2-methylpropanoylamino)carbamoyl]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66686056 |
| Molecular Formula | C17H29N3O6 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 6-[(2-methylpropanoylamino)carbamoyl]piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1CCC(C(=O)NNC(=O)C(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H29N3O6/c1-10(2)13(21)18-19-14(22)12-8-7-11(15(23)25-6)9-20(12)16(24)26-17(3,4)5/h10-12H,7-9H2,1-6H3,(H,18,21)(H,19,22) |
| InChIKey | IOUBUQSNHKHNCD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|