C9H9BrF2N2O — CID 66687850
1-(4-bromo-2,3-difluorophenyl)-3-ethylurea (PubChem CID 66687850) has the molecular formula C9H9BrF2N2O and a molecular weight of 279.08 g/mol. Its IUPAC name is 1-(4-bromo-2,3-difluorophenyl)-3-ethylurea.
| Compound Name | 1-(4-bromo-2,3-difluorophenyl)-3-ethylurea |
|---|---|
| PubChem CID | 66687850 |
| Molecular Formula | C9H9BrF2N2O |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 1-(4-bromo-2,3-difluorophenyl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(Br)c(F)c1F |
| InChI | InChI=1S/C9H9BrF2N2O/c1-2-13-9(15)14-6-4-3-5(10)7(11)8(6)12/h3-4H,2H2,1H3,(H2,13,14,15) |
| InChIKey | PASIUAYWKAIJDQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|