C19H26Cl2FNO3 — CID 66688030
tert-butyl 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylate (PubChem CID 66688030) has the molecular formula C19H26Cl2FNO3 and a molecular weight of 406.33 g/mol. Its IUPAC name is tert-butyl 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66688030 |
| Molecular Formula | C19H26Cl2FNO3 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | tert-butyl 2-[(3,4-dichloro-5-fluorophenyl)-hydroxymethyl]-2-propylpyrrolidine-1-carboxylate |
| SMILES | CCCC1(C(O)c2cc(F)c(Cl)c(Cl)c2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26Cl2FNO3/c1-5-7-19(8-6-9-23(19)17(25)26-18(2,3)4)16(24)12-10-13(20)15(21)14(22)11-12/h10-11,16,24H,5-9H2,1-4H3 |
| InChIKey | VAKLPYPQXGKSGT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|