C9H14ClN3O3 — CID 66690758
N'-[(2-nitrophenoxy)methyl]ethane-1,2-diamine;hydrochloride (PubChem CID 66690758) has the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. Its IUPAC name is N'-[(2-nitrophenoxy)methyl]ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-[(2-nitrophenoxy)methyl]ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 66690758 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N'-[(2-nitrophenoxy)methyl]ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.NCCNCOc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N3O3.ClH/c10-5-6-11-7-15-9-4-2-1-3-8(9)12(13)14;/h1-4,11H,5-7,10H2;1H |
| InChIKey | XTQNGAVDPMLPBE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|