C25H22N2O4 — CID 66693303
1-cyclopropyl-2-(ethoxymethylidene)-3-(6-oxo-1,2-diphenylpyrimidin-5-yl)propane-1,3-dione (PubChem CID 66693303) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 1-cyclopropyl-2-(ethoxymethylidene)-3-(6-oxo-1,2-diphenylpyrimidin-5-yl)propane-1,3-dione.
| Compound Name | 1-cyclopropyl-2-(ethoxymethylidene)-3-(6-oxo-1,2-diphenylpyrimidin-5-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 66693303 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-cyclopropyl-2-(ethoxymethylidene)-3-(6-oxo-1,2-diphenylpyrimidin-5-yl)propane-1,3-dione |
| SMILES | CCOC=C(C(=O)c1cnc(-c2ccccc2)n(-c2ccccc2)c1=O)C(=O)C1CC1 |
| InChI | InChI=1S/C25H22N2O4/c1-2-31-16-21(22(28)17-13-14-17)23(29)20-15-26-24(18-9-5-3-6-10-18)27(25(20)30)19-11-7-4-8-12-19/h3-12,15-17H,2,13-14H2,1H3 |
| InChIKey | MFTVNSSKQAIMGG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|